C14H12FN3 — CID 759208
4-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline (PubChem CID 759208) has the molecular formula C14H12FN3 and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline.
| Compound Name | 4-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 759208 |
| Molecular Formula | C14H12FN3 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
| SMILES | Fc1ccc(NCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C14H12FN3/c15-11-4-6-12(7-5-11)16-9-13-10-18-8-2-1-3-14(18)17-13/h1-8,10,16H,9H2 |
| InChIKey | KEDRVNABWUCIII-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |