C17H19N3O — CID 43123163
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-propan-2-yloxyaniline (PubChem CID 43123163) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-propan-2-yloxyaniline.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 43123163 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1ccc(NCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-13(2)21-16-8-6-14(7-9-16)18-11-15-12-20-10-4-3-5-17(20)19-15/h3-10,12-13,18H,11H2,1-2H3 |
| InChIKey | MSVTYWPJXLWGTP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|