C14H10BrF2N3 — CID 102847163
5-bromo-2,4-difluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline (PubChem CID 102847163) has the molecular formula C14H10BrF2N3 and a molecular weight of 338.16 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline.
| Compound Name | 5-bromo-2,4-difluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 102847163 |
| Molecular Formula | C14H10BrF2N3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(NCc2cn3ccccc3n2)cc1Br |
| InChI | InChI=1S/C14H10BrF2N3/c15-10-5-13(12(17)6-11(10)16)18-7-9-8-20-4-2-1-3-14(20)19-9/h1-6,8,18H,7H2 |
| InChIKey | QNLSIUSYRDBPFM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|