C15H14ClN3 — CID 103768036
2-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methylaniline (PubChem CID 103768036) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methylaniline.
| Compound Name | 2-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methylaniline |
|---|---|
| PubChem CID | 103768036 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-chloro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-5-methylaniline |
| SMILES | Cc1ccc(Cl)c(NCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C15H14ClN3/c1-11-5-6-13(16)14(8-11)17-9-12-10-19-7-3-2-4-15(19)18-12/h2-8,10,17H,9H2,1H3 |
| InChIKey | YXCGCXSMLBYMLS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |