C14H11FN4O2 — CID 36783664
2-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-nitroaniline (PubChem CID 36783664) has the molecular formula C14H11FN4O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-nitroaniline.
| Compound Name | 2-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-nitroaniline |
|---|---|
| PubChem CID | 36783664 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NCc2cn3ccccc3n2)c(F)c1 |
| InChI | InChI=1S/C14H11FN4O2/c15-12-7-11(19(20)21)4-5-13(12)16-8-10-9-18-6-2-1-3-14(18)17-10/h1-7,9,16H,8H2 |
| InChIKey | NGCHXPMHGHUTQA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|