C20H21N3O4S — CID 7626180
imidazo[1,2-a]pyridin-2-ylmethyl 2-piperidin-1-ylsulfonylbenzoate (PubChem CID 7626180) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl 2-piperidin-1-ylsulfonylbenzoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl 2-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7626180 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl 2-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cn2ccccc2n1)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H21N3O4S/c24-20(27-15-16-14-22-11-7-4-10-19(22)21-16)17-8-2-3-9-18(17)28(25,26)23-12-5-1-6-13-23/h2-4,7-11,14H,1,5-6,12-13,15H2 |
| InChIKey | FITGUJJUASBERN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |