C22H23N3O5S — CID 55404353
(4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 55404353) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55404353 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1cc(=O)n2ccccc2n1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C22H23N3O5S/c26-21-15-18(23-20-10-3-6-13-25(20)21)16-30-22(27)17-8-7-9-19(14-17)31(28,29)24-11-4-1-2-5-12-24/h3,6-10,13-15H,1-2,4-5,11-12,16H2 |
| InChIKey | KBYWPJRFGVKUNT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |