C17H20N2O4S2 — CID 18165731
(2-ethyl-1,3-thiazol-4-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 18165731) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 18165731 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CCc1nc(COC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)cs1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-2-16-18-14(12-24-16)11-23-17(20)13-6-5-7-15(10-13)25(21,22)19-8-3-4-9-19/h5-7,10,12H,2-4,8-9,11H2,1H3 |
| InChIKey | DEVPQRRRWFAZIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |