C16H19NO4S — CID 60568114
(2-ethyl-1,3-thiazol-4-yl)methyl 3-(2-methoxyethoxy)benzoate (PubChem CID 60568114) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 3-(2-methoxyethoxy)benzoate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 3-(2-methoxyethoxy)benzoate |
|---|---|
| PubChem CID | 60568114 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 3-(2-methoxyethoxy)benzoate |
| SMILES | CCc1nc(COC(=O)c2cccc(OCCOC)c2)cs1 |
| InChI | InChI=1S/C16H19NO4S/c1-3-15-17-13(11-22-15)10-21-16(18)12-5-4-6-14(9-12)20-8-7-19-2/h4-6,9,11H,3,7-8,10H2,1-2H3 |
| InChIKey | KKSOQONDXAGBOC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|