C17H18N2O2S — CID 24647822
(2-ethyl-1,3-thiazol-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 24647822) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 24647822 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | CCc1nc(COC(=O)c2ccc3[nH]c(C)c(C)c3c2)cs1 |
| InChI | InChI=1S/C17H18N2O2S/c1-4-16-19-13(9-22-16)8-21-17(20)12-5-6-15-14(7-12)10(2)11(3)18-15/h5-7,9,18H,4,8H2,1-3H3 |
| InChIKey | OHMSHOFIUYCSHH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|