C16H19NO3S — CID 60518626
(2-ethyl-1,3-thiazol-4-yl)methyl 3-propoxybenzoate (PubChem CID 60518626) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 3-propoxybenzoate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 3-propoxybenzoate |
|---|---|
| PubChem CID | 60518626 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 3-propoxybenzoate |
| SMILES | CCCOc1cccc(C(=O)OCc2csc(CC)n2)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-3-8-19-14-7-5-6-12(9-14)16(18)20-10-13-11-21-15(4-2)17-13/h5-7,9,11H,3-4,8,10H2,1-2H3 |
| InChIKey | NYGGTNLVXWXALB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |