About propan-2-yl 3-propoxybenzoate
propan-2-yl 3-propoxybenzoate (PubChem CID 60979538) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is propan-2-yl 3-propoxybenzoate.
Molecular Properties
| Compound Name | propan-2-yl 3-propoxybenzoate |
| PubChem CID | 60979538 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | propan-2-yl 3-propoxybenzoate |
| SMILES | CCCOc1cccc(C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C13H18O3/c1-4-8-15-12-7-5-6-11(9-12)13(14)16-10(2)3/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | DSCLFGSNVPJLFN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 3-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-propoxybenzoate?
The IUPAC name of propan-2-yl 3-propoxybenzoate (CID 60979538) is propan-2-yl 3-propoxybenzoate.
What is the SMILES notation for propan-2-yl 3-propoxybenzoate?
The canonical SMILES for propan-2-yl 3-propoxybenzoate is CCCOc1cccc(C(=O)OC(C)C)c1.
What is the InChIKey of propan-2-yl 3-propoxybenzoate?
The InChIKey is DSCLFGSNVPJLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-8-15-12-7-5-6-11(9-12)13(14)16-10(2)3/h5-7,9-10H,4,8H2,1-3H3.
What are the key properties of propan-2-yl 3-propoxybenzoate?
propan-2-yl 3-propoxybenzoate has a molecular weight of 222.28 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-propoxybenzoate is sourced from PubChem (CID 60979538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).