About acetyl 3-propoxybenzoate
acetyl 3-propoxybenzoate (PubChem CID 54339605) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is acetyl 3-propoxybenzoate.
Molecular Properties
| Compound Name | acetyl 3-propoxybenzoate |
| PubChem CID | 54339605 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | acetyl 3-propoxybenzoate |
| SMILES | CCCOc1cccc(C(=O)OC(C)=O)c1 |
| InChI | InChI=1S/C12H14O4/c1-3-7-15-11-6-4-5-10(8-11)12(14)16-9(2)13/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | TXZMAMVQHIHKKA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 3-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 3-propoxybenzoate?
The IUPAC name of acetyl 3-propoxybenzoate (CID 54339605) is acetyl 3-propoxybenzoate.
What is the SMILES notation for acetyl 3-propoxybenzoate?
The canonical SMILES for acetyl 3-propoxybenzoate is CCCOc1cccc(C(=O)OC(C)=O)c1.
What is the InChIKey of acetyl 3-propoxybenzoate?
The InChIKey is TXZMAMVQHIHKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-3-7-15-11-6-4-5-10(8-11)12(14)16-9(2)13/h4-6,8H,3,7H2,1-2H3.
What are the key properties of acetyl 3-propoxybenzoate?
acetyl 3-propoxybenzoate has a molecular weight of 222.24 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 3-propoxybenzoate is sourced from PubChem (CID 54339605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).