About [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate
[3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate (PubChem CID 17161878) has the molecular formula C25H24O6
and a molecular weight of 420.46 g/mol. Its IUPAC name is [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate.
Molecular Properties
| Compound Name | [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate |
| PubChem CID | 17161878 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate |
| SMILES | CCCOc1cccc(C(=O)Oc2cccc(C(=O)OCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H24O6/c1-2-14-28-22-12-6-9-20(17-22)25(27)31-23-13-7-8-19(18-23)24(26)30-16-15-29-21-10-4-3-5-11-21/h3-13,17-18H,2,14-16H2,1H3 |
| InChIKey | YKDFAVDQVZALMM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate?
The IUPAC name of [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate (CID 17161878) is [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate.
What is the SMILES notation for [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate?
The canonical SMILES for [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate is CCCOc1cccc(C(=O)Oc2cccc(C(=O)OCCOc3ccccc3)c2)c1.
What is the InChIKey of [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate?
The InChIKey is YKDFAVDQVZALMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24O6/c1-2-14-28-22-12-6-9-20(17-22)25(27)31-23-13-7-8-19(18-23)24(26)30-16-15-29-21-10-4-3-5-11-21/h3-13,17-18H,2,14-16H2,1H3.
What are the key properties of [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate?
[3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate has a molecular weight of 420.46 g/mol, XLogP of 4.93, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-phenoxyethoxycarbonyl)phenyl] 3-propoxybenzoate is sourced from PubChem (CID 17161878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).