C27H28O6 — CID 17161856
2-phenoxyethyl 3-(4-pentoxybenzoyl)oxybenzoate (PubChem CID 17161856) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-phenoxyethyl 3-(4-pentoxybenzoyl)oxybenzoate.
| Compound Name | 2-phenoxyethyl 3-(4-pentoxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 17161856 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-phenoxyethyl 3-(4-pentoxybenzoyl)oxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2cccc(C(=O)OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H28O6/c1-2-3-7-17-30-24-15-13-21(14-16-24)27(29)33-25-12-8-9-22(20-25)26(28)32-19-18-31-23-10-5-4-6-11-23/h4-6,8-16,20H,2-3,7,17-19H2,1H3 |
| InChIKey | GGUQIHZTLBPUCR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|