C23H28O5 — CID 17171202
2-methylpropyl 3-(4-pentoxybenzoyl)oxybenzoate (PubChem CID 17171202) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-methylpropyl 3-(4-pentoxybenzoyl)oxybenzoate.
| Compound Name | 2-methylpropyl 3-(4-pentoxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 17171202 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-methylpropyl 3-(4-pentoxybenzoyl)oxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2cccc(C(=O)OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C23H28O5/c1-4-5-6-14-26-20-12-10-18(11-13-20)23(25)28-21-9-7-8-19(15-21)22(24)27-16-17(2)3/h7-13,15,17H,4-6,14,16H2,1-3H3 |
| InChIKey | IVJXUJDWDVIETN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|