C16H17N3O3 — CID 18130420
(5-ethyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 18130420) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (5-ethyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | (5-ethyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 18130420 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (5-ethyl-1,3,4-oxadiazol-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | CCc1nnc(COC(=O)c2ccc3[nH]c(C)c(C)c3c2)o1 |
| InChI | InChI=1S/C16H17N3O3/c1-4-14-18-19-15(22-14)8-21-16(20)11-5-6-13-12(7-11)9(2)10(3)17-13/h5-7,17H,4,8H2,1-3H3 |
| InChIKey | NTKYWWHZHZPKIK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|