C21H17NO5 — CID 9291512
(7-hydroxy-2-oxochromen-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 9291512) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 9291512 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OCc3cc(=O)oc4cc(O)ccc34)cc2c1C |
| InChI | InChI=1S/C21H17NO5/c1-11-12(2)22-18-6-3-13(7-17(11)18)21(25)26-10-14-8-20(24)27-19-9-15(23)4-5-16(14)19/h3-9,22-23H,10H2,1-2H3 |
| InChIKey | GBTXZIPNSMPVLO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|