C21H14FNO5S — CID 8513438
(7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 8513438) has the molecular formula C21H14FNO5S and a molecular weight of 411.41 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 8513438 |
| Molecular Formula | C21H14FNO5S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C21H14FNO5S/c1-11-19(29-20(23-11)12-2-4-14(22)5-3-12)21(26)27-10-13-8-18(25)28-17-9-15(24)6-7-16(13)17/h2-9,24H,10H2,1H3 |
| InChIKey | SXNCFXHJPCGUPU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|