C23H17FN2O5S — CID 55394614
(7-acetamido-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55394614) has the molecular formula C23H17FN2O5S and a molecular weight of 452.46 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55394614 |
| Molecular Formula | C23H17FN2O5S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-(4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3sc(-c4ccc(F)cc4)nc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H17FN2O5S/c1-12-21(32-22(25-12)14-3-5-16(24)6-4-14)23(29)30-11-15-9-20(28)31-19-10-17(26-13(2)27)7-8-18(15)19/h3-10H,11H2,1-2H3,(H,26,27) |
| InChIKey | ZMPLZXVALVCABF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|