C17H14N2O8S — CID 55643841
(7-acetamido-2-oxochromen-4-yl)methyl 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643841) has the molecular formula C17H14N2O8S and a molecular weight of 406.37 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 5-sulfamoylfuran-2-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643841 |
| Molecular Formula | C17H14N2O8S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3ccc(S(N)(=O)=O)o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H14N2O8S/c1-9(20)19-11-2-3-12-10(6-15(21)26-14(12)7-11)8-25-17(22)13-4-5-16(27-13)28(18,23)24/h2-7H,8H2,1H3,(H,19,20)(H2,18,23,24) |
| InChIKey | UBICULPAZDXWOW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|