C23H19N3O5 — CID 16575866
(7-acetamido-2-oxochromen-4-yl)methyl 1-benzylpyrazole-4-carboxylate (PubChem CID 16575866) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 1-benzylpyrazole-4-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 1-benzylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16575866 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 1-benzylpyrazole-4-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3cnn(Cc4ccccc4)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H19N3O5/c1-15(27)25-19-7-8-20-17(9-22(28)31-21(20)10-19)14-30-23(29)18-11-24-26(13-18)12-16-5-3-2-4-6-16/h2-11,13H,12,14H2,1H3,(H,25,27) |
| InChIKey | XOKZRLIPCJBIKP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|