C25H21N3O7 — CID 2394646
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 1-benzyl-6-oxopyridazine-3-carboxylate (PubChem CID 2394646) has the molecular formula C25H21N3O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 1-benzyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 1-benzyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 2394646 |
| Molecular Formula | C25H21N3O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 1-benzyl-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3ccc(=O)n(Cc4ccccc4)n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H21N3O7/c1-2-33-25(32)26-18-8-9-19-17(12-23(30)35-21(19)13-18)15-34-24(31)20-10-11-22(29)28(27-20)14-16-6-4-3-5-7-16/h3-13H,2,14-15H2,1H3,(H,26,32) |
| InChIKey | WDOTWGWBYLHROL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|