C23H23NO6 — CID 7904603
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(3,4-dimethylphenyl)acetate (PubChem CID 7904603) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(3,4-dimethylphenyl)acetate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 7904603 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(3,4-dimethylphenyl)acetate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)Cc3ccc(C)c(C)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H23NO6/c1-4-28-23(27)24-18-7-8-19-17(11-22(26)30-20(19)12-18)13-29-21(25)10-16-6-5-14(2)15(3)9-16/h5-9,11-12H,4,10,13H2,1-3H3,(H,24,27) |
| InChIKey | ASBFSACANPBTFU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|