C22H21NO8S — CID 55311981
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 55311981) has the molecular formula C22H21NO8S and a molecular weight of 459.48 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 55311981 |
| Molecular Formula | C22H21NO8S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3cc(S(C)(=O)=O)ccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO8S/c1-4-29-22(26)23-15-6-8-17-14(9-20(24)31-19(17)10-15)12-30-21(25)18-11-16(32(3,27)28)7-5-13(18)2/h5-11H,4,12H2,1-3H3,(H,23,26) |
| InChIKey | ZCQXFOSIAHYBKH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|