C22H21NO8 — CID 41463805
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(4-methoxyphenoxy)acetate (PubChem CID 41463805) has the molecular formula C22H21NO8 and a molecular weight of 427.41 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(4-methoxyphenoxy)acetate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 41463805 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(4-methoxyphenoxy)acetate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)COc3ccc(OC)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO8/c1-3-28-22(26)23-15-4-9-18-14(10-20(24)31-19(18)11-15)12-30-21(25)13-29-17-7-5-16(27-2)6-8-17/h4-11H,3,12-13H2,1-2H3,(H,23,26) |
| InChIKey | STOXYMPPVXJXBU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|