C21H19NO6S — CID 40619628
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-phenylsulfanylacetate (PubChem CID 40619628) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-phenylsulfanylacetate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 40619628 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-phenylsulfanylacetate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)CSc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H19NO6S/c1-2-26-21(25)22-15-8-9-17-14(10-19(23)28-18(17)11-15)12-27-20(24)13-29-16-6-4-3-5-7-16/h3-11H,2,12-13H2,1H3,(H,22,25) |
| InChIKey | TWWJDEPBUPWGHZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|