C22H21NO7S — CID 55374719
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-ethylsulfinylbenzoate (PubChem CID 55374719) has the molecular formula C22H21NO7S and a molecular weight of 443.48 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-ethylsulfinylbenzoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-ethylsulfinylbenzoate |
|---|---|
| PubChem CID | 55374719 |
| Molecular Formula | C22H21NO7S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-ethylsulfinylbenzoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3ccccc3S(=O)CC)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO7S/c1-3-28-22(26)23-15-9-10-16-14(11-20(24)30-18(16)12-15)13-29-21(25)17-7-5-6-8-19(17)31(27)4-2/h5-12H,3-4,13H2,1-2H3,(H,23,26) |
| InChIKey | VPFKXXOZMDCTAJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|