C25H21NO8 — CID 42450559
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-(phenoxymethyl)furan-2-carboxylate (PubChem CID 42450559) has the molecular formula C25H21NO8 and a molecular weight of 463.44 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 42450559 |
| Molecular Formula | C25H21NO8 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-(phenoxymethyl)furan-2-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3occc3COc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H21NO8/c1-2-30-25(29)26-18-8-9-20-17(12-22(27)34-21(20)13-18)15-33-24(28)23-16(10-11-31-23)14-32-19-6-4-3-5-7-19/h3-13H,2,14-15H2,1H3,(H,26,29) |
| InChIKey | PXPAFUKEQHUWBN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|