C18H15NO7 — CID 7891680
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl furan-2-carboxylate (PubChem CID 7891680) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl furan-2-carboxylate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl furan-2-carboxylate |
|---|---|
| PubChem CID | 7891680 |
| Molecular Formula | C18H15NO7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl furan-2-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3ccco3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H15NO7/c1-2-23-18(22)19-12-5-6-13-11(8-16(20)26-15(13)9-12)10-25-17(21)14-4-3-7-24-14/h3-9H,2,10H2,1H3,(H,19,22) |
| InChIKey | XCOLHSZIDZBSAI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|