C18H17Cl2NO6 — CID 7864026
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 7864026) has the molecular formula C18H17Cl2NO6 and a molecular weight of 414.24 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7864026 |
| Molecular Formula | C18H17Cl2NO6 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)[C@]3(C)CC3(Cl)Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H17Cl2NO6/c1-3-25-16(24)21-11-4-5-12-10(6-14(22)27-13(12)7-11)8-26-15(23)17(2)9-18(17,19)20/h4-7H,3,8-9H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | GYLBTQXCXUIPKT-KRWDZBQOSA-N |
| XLogP | 3.99 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|