C21H26N2O8 — CID 55405594
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 55405594) has the molecular formula C21H26N2O8 and a molecular weight of 434.45 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 55405594 |
| Molecular Formula | C21H26N2O8 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)CCNC(=O)OC(C)(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H26N2O8/c1-5-28-20(27)23-14-6-7-15-13(10-18(25)30-16(15)11-14)12-29-17(24)8-9-22-19(26)31-21(2,3)4/h6-7,10-11H,5,8-9,12H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | KHEUFHFREMMPRI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|