C21H27NO6 — CID 8947250
(7-ethyl-2-oxochromen-4-yl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 8947250) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 8947250 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCc1ccc2c(COC(=O)CCCNC(=O)OC(C)(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H27NO6/c1-5-14-8-9-16-15(12-19(24)27-17(16)11-14)13-26-18(23)7-6-10-22-20(25)28-21(2,3)4/h8-9,11-12H,5-7,10,13H2,1-4H3,(H,22,25) |
| InChIKey | RMKOIQAHMXTBOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|