C19H18O4S — CID 8878180
(7-ethyl-2-oxochromen-4-yl)methyl 2,5-dimethylthiophene-3-carboxylate (PubChem CID 8878180) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 2,5-dimethylthiophene-3-carboxylate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8878180 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 2,5-dimethylthiophene-3-carboxylate |
| SMILES | CCc1ccc2c(COC(=O)c3cc(C)sc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H18O4S/c1-4-13-5-6-15-14(9-18(20)23-17(15)8-13)10-22-19(21)16-7-11(2)24-12(16)3/h5-9H,4,10H2,1-3H3 |
| InChIKey | JOVFWOHKUCGHTO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|