C20H19NO6S — CID 7740586
(7-ethyl-2-oxochromen-4-yl)methyl 2-(methanesulfonamido)benzoate (PubChem CID 7740586) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 2-(methanesulfonamido)benzoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 7740586 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 2-(methanesulfonamido)benzoate |
| SMILES | CCc1ccc2c(COC(=O)c3ccccc3NS(C)(=O)=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H19NO6S/c1-3-13-8-9-15-14(11-19(22)27-18(15)10-13)12-26-20(23)16-6-4-5-7-17(16)21-28(2,24)25/h4-11,21H,3,12H2,1-2H3 |
| InChIKey | XPAUCTCLZKVHNE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|