About (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate
(7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate (PubChem CID 8791114) has the molecular formula C21H20O5
and a molecular weight of 352.39 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate.
Molecular Properties
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate |
| PubChem CID | 8791114 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate |
| SMILES | CCc1ccc2c(COC(=O)[C@@H](C)Oc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H20O5/c1-3-15-9-10-18-16(12-20(22)26-19(18)11-15)13-24-21(23)14(2)25-17-7-5-4-6-8-17/h4-12,14H,3,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | QUOZAGBOCHRPMC-CQSZACIVSA-N |
| XLogP | 3.87 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate?
The IUPAC name of (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate (CID 8791114) is (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate.
What is the SMILES notation for (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate?
The canonical SMILES for (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate is CCc1ccc2c(COC(=O)[C@@H](C)Oc3ccccc3)cc(=O)oc2c1.
What is the InChIKey of (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate?
The InChIKey is QUOZAGBOCHRPMC-CQSZACIVSA-N. The full InChI is InChI=1S/C21H20O5/c1-3-15-9-10-18-16(12-20(22)26-19(18)11-15)13-24-21(23)14(2)25-17-7-5-4-6-8-17/h4-12,14H,3,13H2,1-2H3/t14-/m1/s1.
What are the key properties of (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate?
(7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate has a molecular weight of 352.39 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-2-oxochromen-4-yl)methyl (2R)-2-phenoxypropanoate is sourced from PubChem (CID 8791114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).