C20H15NO6 — CID 7983794
(7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(4-cyanophenoxy)propanoate (PubChem CID 7983794) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(4-cyanophenoxy)propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7983794 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H15NO6/c1-12(26-16-5-2-13(10-21)3-6-16)20(24)25-11-14-8-19(23)27-18-9-15(22)4-7-17(14)18/h2-9,12,22H,11H2,1H3/t12-/m1/s1 |
| InChIKey | ZAMVXCITGCHYTP-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|