C21H15NO7 — CID 8926473
(7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926473) has the molecular formula C21H15NO7 and a molecular weight of 393.35 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926473 |
| Molecular Formula | C21H15NO7 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@H](C(=O)OCc1cc(=O)oc2cc(O)ccc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H15NO7/c1-11(22-19(25)15-4-2-3-5-16(15)20(22)26)21(27)28-10-12-8-18(24)29-17-9-13(23)6-7-14(12)17/h2-9,11,23H,10H2,1H3/t11-/m1/s1 |
| InChIKey | MDEMGUFYYPITDZ-LLVKDONJSA-N |
| XLogP | 2.23 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|