C28H23NO6 — CID 3361942
(3-oxobenzo[f]chromen-1-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 3361942) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 3361942 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCc1cc(=O)oc2ccc3ccccc3c12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H23NO6/c1-16(2)13-22(29-26(31)20-9-5-6-10-21(20)27(29)32)28(33)34-15-18-14-24(30)35-23-12-11-17-7-3-4-8-19(17)25(18)23/h3-12,14,16,22H,13,15H2,1-2H3 |
| InChIKey | WAQSBNNRLUVGDP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|