C23H19NO6 — CID 8926558
(6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926558) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926558 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)[C@H](C)N3C(=O)c4ccccc4C3=O)c2cc1C |
| InChI | InChI=1S/C23H19NO6/c1-12-8-18-15(10-20(25)30-19(18)9-13(12)2)11-29-23(28)14(3)24-21(26)16-6-4-5-7-17(16)22(24)27/h4-10,14H,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | RSLVENQOCYZDIL-AWEZNQCLSA-N |
| XLogP | 3.14 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|