C25H22N2O8 — CID 46816717
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46816717) has the molecular formula C25H22N2O8 and a molecular weight of 478.46 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46816717 |
| Molecular Formula | C25H22N2O8 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)C(C)N3C(=O)c4ccc(C)cc4C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H22N2O8/c1-4-33-25(32)26-16-6-8-17-15(10-21(28)35-20(17)11-16)12-34-24(31)14(3)27-22(29)18-7-5-13(2)9-19(18)23(27)30/h5-11,14H,4,12H2,1-3H3,(H,26,32) |
| InChIKey | QIUVVCIGAXVEKO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|