C22H16ClNO6 — CID 35834431
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 35834431) has the molecular formula C22H16ClNO6 and a molecular weight of 425.82 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 35834431 |
| Molecular Formula | C22H16ClNO6 |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)[C@H](C)N3C(=O)c4ccccc4C3=O)c2cc1Cl |
| InChI | InChI=1S/C22H16ClNO6/c1-11-7-18-16(9-17(11)23)13(8-19(25)30-18)10-29-22(28)12(2)24-20(26)14-5-3-4-6-15(14)21(24)27/h3-9,12H,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | KHPGRRUYHPTMNR-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|