C20H13ClN2O5 — CID 8785162
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 8785162) has the molecular formula C20H13ClN2O5 and a molecular weight of 396.79 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8785162 |
| Molecular Formula | C20H13ClN2O5 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3n[nH]c(=O)c4ccccc34)c2cc1Cl |
| InChI | InChI=1S/C20H13ClN2O5/c1-10-6-16-14(8-15(10)21)11(7-17(24)28-16)9-27-20(26)18-12-4-2-3-5-13(12)19(25)23-22-18/h2-8H,9H2,1H3,(H,23,25) |
| InChIKey | MQPUNEFPSFUYOG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|