C16H13ClN2O5 — CID 7195010
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (PubChem CID 7195010) has the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7195010 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C3=NNC(=O)CC3)c2cc1Cl |
| InChI | InChI=1S/C16H13ClN2O5/c1-8-4-13-10(6-11(8)17)9(5-15(21)24-13)7-23-16(22)12-2-3-14(20)19-18-12/h4-6H,2-3,7H2,1H3,(H,19,20) |
| InChIKey | CDXZXZNCZPJKMP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|