About (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate (PubChem CID 7702436) has the molecular formula C16H11ClN2O4
and a molecular weight of 330.73 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate |
| PubChem CID | 7702436 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cnccn3)c2cc1Cl |
| InChI | InChI=1S/C16H11ClN2O4/c1-9-4-14-11(6-12(9)17)10(5-15(20)23-14)8-22-16(21)13-7-18-2-3-19-13/h2-7H,8H2,1H3 |
| InChIKey | MDFBRSVPFHIXDB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate?
The IUPAC name of (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate (CID 7702436) is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate.
What is the SMILES notation for (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate?
The canonical SMILES for (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate is Cc1cc2oc(=O)cc(COC(=O)c3cnccn3)c2cc1Cl.
What is the InChIKey of (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate?
The InChIKey is MDFBRSVPFHIXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O4/c1-9-4-14-11(6-12(9)17)10(5-15(20)23-14)8-22-16(21)13-7-18-2-3-19-13/h2-7H,8H2,1H3.
What are the key properties of (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate?
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate has a molecular weight of 330.73 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-7-methyl-2-oxochromen-4-yl)methyl pyrazine-2-carboxylate is sourced from PubChem (CID 7702436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).