C16H12ClN3O4 — CID 7469234
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate (PubChem CID 7469234) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7469234 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3nccnc3N)c2cc1Cl |
| InChI | InChI=1S/C16H12ClN3O4/c1-8-4-12-10(6-11(8)17)9(5-13(21)24-12)7-23-16(22)14-15(18)20-3-2-19-14/h2-6H,7H2,1H3,(H2,18,20) |
| InChIKey | YESPQNAALQWZHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|