C17H10Cl3NO4 — CID 8021608
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021608) has the molecular formula C17H10Cl3NO4 and a molecular weight of 398.63 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5,6-dichloropyridine-3-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021608 |
| Molecular Formula | C17H10Cl3NO4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5,6-dichloropyridine-3-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cnc(Cl)c(Cl)c3)c2cc1Cl |
| InChI | InChI=1S/C17H10Cl3NO4/c1-8-2-14-11(5-12(8)18)10(4-15(22)25-14)7-24-17(23)9-3-13(19)16(20)21-6-9/h2-6H,7H2,1H3 |
| InChIKey | FJAFACIRGXVWKW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|