C21H19ClO6 — CID 7362858
(6,7-dimethyl-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate (PubChem CID 7362858) has the molecular formula C21H19ClO6 and a molecular weight of 402.83 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7362858 |
| Molecular Formula | C21H19ClO6 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)oc3cc(C)c(C)cc23)cc(Cl)c1OC |
| InChI | InChI=1S/C21H19ClO6/c1-11-5-15-14(9-19(23)28-17(15)6-12(11)2)10-27-21(24)13-7-16(22)20(26-4)18(8-13)25-3/h5-9H,10H2,1-4H3 |
| InChIKey | HKLDGTYNRGZPHY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|