C21H17ClO7 — CID 7645851
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 7645851) has the molecular formula C21H17ClO7 and a molecular weight of 416.81 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 7645851 |
| Molecular Formula | C21H17ClO7 |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)oc3cc(C)c(Cl)cc23)cc2c1OCCO2 |
| InChI | InChI=1S/C21H17ClO7/c1-11-5-16-14(9-15(11)22)13(8-19(23)29-16)10-28-21(24)12-6-17(25-2)20-18(7-12)26-3-4-27-20/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | VKVYOXOLDCPJKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|