C16H13N3O5 — CID 7469232
(7-methoxy-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate (PubChem CID 7469232) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7469232 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 3-aminopyrazine-2-carboxylate |
| SMILES | COc1ccc2c(COC(=O)c3nccnc3N)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H13N3O5/c1-22-10-2-3-11-9(6-13(20)24-12(11)7-10)8-23-16(21)14-15(17)19-5-4-18-14/h2-7H,8H2,1H3,(H2,17,19) |
| InChIKey | UMEXLPMHDPOSNJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|